C24H26F2N2O — CID 3618198
4-fluoro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentylbenzamide (PubChem CID 3618198) has the molecular formula C24H26F2N2O and a molecular weight of 396.48 g/mol. Its IUPAC name is 4-fluoro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentylbenzamide.
| Compound Name | 4-fluoro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 3618198 |
| Molecular Formula | C24H26F2N2O |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4-fluoro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(F)c1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H26F2N2O/c1-2-3-4-14-28(24(29)20-10-12-21(25)13-11-20)18-23-9-6-15-27(23)17-19-7-5-8-22(26)16-19/h5-13,15-16H,2-4,14,17-18H2,1H3 |
| InChIKey | CDPRMWULBRBRMI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|