C26H31FN2O3 — CID 4541290
N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3,5-dimethoxy-N-pentylbenzamide (PubChem CID 4541290) has the molecular formula C26H31FN2O3 and a molecular weight of 438.54 g/mol. Its IUPAC name is N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3,5-dimethoxy-N-pentylbenzamide.
| Compound Name | N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3,5-dimethoxy-N-pentylbenzamide |
|---|---|
| PubChem CID | 4541290 |
| Molecular Formula | C26H31FN2O3 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3,5-dimethoxy-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(F)c1)C(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C26H31FN2O3/c1-4-5-6-12-29(26(30)21-15-24(31-2)17-25(16-21)32-3)19-23-11-8-13-28(23)18-20-9-7-10-22(27)14-20/h7-11,13-17H,4-6,12,18-19H2,1-3H3 |
| InChIKey | DUQTVKGHEUKCRA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|