C38H47N3O3 — CID 42771293
N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butyl-N-pentylbenzamide (PubChem CID 42771293) has the molecular formula C38H47N3O3 and a molecular weight of 593.81 g/mol. Its IUPAC name is N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butyl-N-pentylbenzamide.
| Compound Name | N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butyl-N-pentylbenzamide |
|---|---|
| PubChem CID | 42771293 |
| Molecular Formula | C38H47N3O3 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.36 |
| IUPAC Name | N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butyl-N-pentylbenzamide |
| SMILES | CCCCCN(CC(=O)N(Cc1ccccc1)Cc1cccn1Cc1cccc(OC)c1)C(=O)c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C38H47N3O3/c1-4-6-11-24-40(38(43)34-22-20-31(21-23-34)14-7-5-2)30-37(42)41(27-32-15-9-8-10-16-32)29-35-18-13-25-39(35)28-33-17-12-19-36(26-33)44-3/h8-10,12-13,15-23,25-26H,4-7,11,14,24,27-30H2,1-3H3 |
| InChIKey | KNVRGMUXPGDHQM-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|