C34H37Cl2N3O3 — CID 42771289
N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-2,4-dichloro-N-pentylbenzamide (PubChem CID 42771289) has the molecular formula C34H37Cl2N3O3 and a molecular weight of 606.59 g/mol. Its IUPAC name is N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-2,4-dichloro-N-pentylbenzamide.
| Compound Name | N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-2,4-dichloro-N-pentylbenzamide |
|---|---|
| PubChem CID | 42771289 |
| Molecular Formula | C34H37Cl2N3O3 |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-2,4-dichloro-N-pentylbenzamide |
| SMILES | CCCCCN(CC(=O)N(Cc1ccccc1)Cc1cccn1Cc1cccc(OC)c1)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C34H37Cl2N3O3/c1-3-4-8-18-38(34(41)31-17-16-28(35)21-32(31)36)25-33(40)39(22-26-11-6-5-7-12-26)24-29-14-10-19-37(29)23-27-13-9-15-30(20-27)42-2/h5-7,9-17,19-21H,3-4,8,18,22-25H2,1-2H3 |
| InChIKey | KZHAXIQGWLOTAF-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|