C32H41N3O3 — CID 42664397
N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-pentylcyclobutanecarboxamide (PubChem CID 42664397) has the molecular formula C32H41N3O3 and a molecular weight of 515.70 g/mol. Its IUPAC name is N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-pentylcyclobutanecarboxamide.
| Compound Name | N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-pentylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 42664397 |
| Molecular Formula | C32H41N3O3 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-pentylcyclobutanecarboxamide |
| SMILES | CCCCCN(CC(=O)N(Cc1ccccc1)Cc1cccn1Cc1cccc(OC)c1)C(=O)C1CCC1 |
| InChI | InChI=1S/C32H41N3O3/c1-3-4-8-19-34(32(37)28-15-10-16-28)25-31(36)35(22-26-12-6-5-7-13-26)24-29-17-11-20-33(29)23-27-14-9-18-30(21-27)38-2/h5-7,9,11-14,17-18,20-21,28H,3-4,8,10,15-16,19,22-25H2,1-2H3 |
| InChIKey | OQOHNAKOCZQEAE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|