C22H29ClN2O — CID 5161057
N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentylcyclobutanecarboxamide (PubChem CID 5161057) has the molecular formula C22H29ClN2O and a molecular weight of 372.94 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentylcyclobutanecarboxamide.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 5161057 |
| Molecular Formula | C22H29ClN2O |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentylcyclobutanecarboxamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)C1CCC1 |
| InChI | InChI=1S/C22H29ClN2O/c1-2-3-4-13-25(22(26)19-9-6-10-19)17-21-12-7-14-24(21)16-18-8-5-11-20(23)15-18/h5,7-8,11-12,14-15,19H,2-4,6,9-10,13,16-17H2,1H3 |
| InChIKey | HXRIJCJFXOOJOB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|