C25H30ClN3O — CID 3931866
3-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea (PubChem CID 3931866) has the molecular formula C25H30ClN3O and a molecular weight of 423.99 g/mol. Its IUPAC name is 3-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea.
| Compound Name | 3-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea |
|---|---|
| PubChem CID | 3931866 |
| Molecular Formula | C25H30ClN3O |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 3-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H30ClN3O/c1-2-3-7-15-29(25(30)27-18-21-10-5-4-6-11-21)20-24-14-9-16-28(24)19-22-12-8-13-23(26)17-22/h4-6,8-14,16-17H,2-3,7,15,18-20H2,1H3,(H,27,30) |
| InChIKey | DNXWETNYFPWUAJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|