C26H38N2O2 — CID 3270259
3-cyclopentyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-N-pentylpropanamide (PubChem CID 3270259) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is 3-cyclopentyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-N-pentylpropanamide.
| Compound Name | 3-cyclopentyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-N-pentylpropanamide |
|---|---|
| PubChem CID | 3270259 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 3-cyclopentyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-N-pentylpropanamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(OC)c1)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C26H38N2O2/c1-3-4-7-17-28(26(29)16-15-22-10-5-6-11-22)21-24-13-9-18-27(24)20-23-12-8-14-25(19-23)30-2/h8-9,12-14,18-19,22H,3-7,10-11,15-17,20-21H2,1-2H3 |
| InChIKey | XHJBVVSEJBIBKU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|