C27H39F3N2O2 — CID 42763478
N-(3-methoxypropyl)-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]decanamide (PubChem CID 42763478) has the molecular formula C27H39F3N2O2 and a molecular weight of 480.62 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]decanamide.
| Compound Name | N-(3-methoxypropyl)-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]decanamide |
|---|---|
| PubChem CID | 42763478 |
| Molecular Formula | C27H39F3N2O2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | N-(3-methoxypropyl)-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]decanamide |
| SMILES | CCCCCCCCCC(=O)N(CCCOC)Cc1cccn1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H39F3N2O2/c1-3-4-5-6-7-8-9-16-26(33)32(18-12-19-34-2)22-25-15-11-17-31(25)21-23-13-10-14-24(20-23)27(28,29)30/h10-11,13-15,17,20H,3-9,12,16,18-19,21-22H2,1-2H3 |
| InChIKey | KOBSPDYSCHRMPS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|