C20H24ClF3N2O2 — CID 7283456
(2S)-2-chloro-N-(3-methoxypropyl)-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide (PubChem CID 7283456) has the molecular formula C20H24ClF3N2O2 and a molecular weight of 416.87 g/mol. Its IUPAC name is (2S)-2-chloro-N-(3-methoxypropyl)-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide.
| Compound Name | (2S)-2-chloro-N-(3-methoxypropyl)-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 7283456 |
| Molecular Formula | C20H24ClF3N2O2 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (2S)-2-chloro-N-(3-methoxypropyl)-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide |
| SMILES | COCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)[C@H](C)Cl |
| InChI | InChI=1S/C20H24ClF3N2O2/c1-15(21)19(27)26(10-5-11-28-2)14-18-8-4-9-25(18)13-16-6-3-7-17(12-16)20(22,23)24/h3-4,6-9,12,15H,5,10-11,13-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | UCAUXOALXSMCEJ-HNNXBMFYSA-N |
| XLogP | 4.55 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|