C26H29F3N2O2 — CID 42763467
N-(3-methoxypropyl)-3-phenyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide (PubChem CID 42763467) has the molecular formula C26H29F3N2O2 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3-phenyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide.
| Compound Name | N-(3-methoxypropyl)-3-phenyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 42763467 |
| Molecular Formula | C26H29F3N2O2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | N-(3-methoxypropyl)-3-phenyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide |
| SMILES | COCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C26H29F3N2O2/c1-33-17-7-16-31(25(32)14-13-21-8-3-2-4-9-21)20-24-12-6-15-30(24)19-22-10-5-11-23(18-22)26(27,28)29/h2-6,8-12,15,18H,7,13-14,16-17,19-20H2,1H3 |
| InChIKey | RVZFFAUFNKNLBC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|