C33H33F3N4O5 — CID 3375800
N-benzyl-N-[2-[3-methoxypropyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 3375800) has the molecular formula C33H33F3N4O5 and a molecular weight of 622.64 g/mol. Its IUPAC name is N-benzyl-N-[2-[3-methoxypropyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-benzyl-N-[2-[3-methoxypropyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3375800 |
| Molecular Formula | C33H33F3N4O5 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | N-benzyl-N-[2-[3-methoxypropyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | COCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)CN(Cc1ccccc1)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H33F3N4O5/c1-45-19-7-18-38(23-30-12-6-17-37(30)22-26-10-5-11-28(20-26)33(34,35)36)31(41)24-39(21-25-8-3-2-4-9-25)32(42)27-13-15-29(16-14-27)40(43)44/h2-6,8-17,20H,7,18-19,21-24H2,1H3 |
| InChIKey | SRRSMLXZOVASSC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|