C25H27F3N2O3 — CID 3295927
N-(3-methoxypropyl)-2-phenoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]acetamide (PubChem CID 3295927) has the molecular formula C25H27F3N2O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-phenoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-phenoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 3295927 |
| Molecular Formula | C25H27F3N2O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-(3-methoxypropyl)-2-phenoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]acetamide |
| SMILES | COCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C25H27F3N2O3/c1-32-15-7-14-30(24(31)19-33-23-11-3-2-4-12-23)18-22-10-6-13-29(22)17-20-8-5-9-21(16-20)25(26,27)28/h2-6,8-13,16H,7,14-15,17-19H2,1H3 |
| InChIKey | FKCCDPMKQSAEAM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|