C24H25F3N2O — CID 3455354
N-benzyl-2-methyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide (PubChem CID 3455354) has the molecular formula C24H25F3N2O and a molecular weight of 414.47 g/mol. Its IUPAC name is N-benzyl-2-methyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide.
| Compound Name | N-benzyl-2-methyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 3455354 |
| Molecular Formula | C24H25F3N2O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-benzyl-2-methyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide |
| SMILES | CC(C)C(=O)N(Cc1ccccc1)Cc1cccn1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H25F3N2O/c1-18(2)23(30)29(15-19-8-4-3-5-9-19)17-22-12-7-13-28(22)16-20-10-6-11-21(14-20)24(25,26)27/h3-14,18H,15-17H2,1-2H3 |
| InChIKey | OYDVKKZSRUMGLG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |