C28H25F3N2O2 — CID 3546858
N-benzyl-2-methoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 3546858) has the molecular formula C28H25F3N2O2 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-benzyl-2-methoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | N-benzyl-2-methoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 3546858 |
| Molecular Formula | C28H25F3N2O2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-benzyl-2-methoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | COc1ccccc1C(=O)N(Cc1ccccc1)Cc1cccn1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H25F3N2O2/c1-35-26-15-6-5-14-25(26)27(34)33(18-21-9-3-2-4-10-21)20-24-13-8-16-32(24)19-22-11-7-12-23(17-22)28(29,30)31/h2-17H,18-20H2,1H3 |
| InChIKey | GDYISYDRXCEWRW-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |