C23H24F3N3O — CID 3651212
1-benzyl-3-ethyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea (PubChem CID 3651212) has the molecular formula C23H24F3N3O and a molecular weight of 415.46 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea.
| Compound Name | 1-benzyl-3-ethyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 3651212 |
| Molecular Formula | C23H24F3N3O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-benzyl-3-ethyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea |
| SMILES | CCNC(=O)N(Cc1ccccc1)Cc1cccn1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F3N3O/c1-2-27-22(30)29(15-18-8-4-3-5-9-18)17-21-12-7-13-28(21)16-19-10-6-11-20(14-19)23(24,25)26/h3-14H,2,15-17H2,1H3,(H,27,30) |
| InChIKey | QITVUEYVNSMZDB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |