C24H24ClF3N2O — CID 5095657
N-butyl-3-chloro-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 5095657) has the molecular formula C24H24ClF3N2O and a molecular weight of 448.92 g/mol. Its IUPAC name is N-butyl-3-chloro-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | N-butyl-3-chloro-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 5095657 |
| Molecular Formula | C24H24ClF3N2O |
| Molecular Weight | 448.92 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-butyl-3-chloro-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | CCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H24ClF3N2O/c1-2-3-12-30(23(31)19-8-5-10-21(25)15-19)17-22-11-6-13-29(22)16-18-7-4-9-20(14-18)24(26,27)28/h4-11,13-15H,2-3,12,16-17H2,1H3 |
| InChIKey | SGEVJUDFKSFVBE-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.92 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |