C25H27F3N2O2 — CID 5214112
N-butyl-2-methoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 5214112) has the molecular formula C25H27F3N2O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is N-butyl-2-methoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | N-butyl-2-methoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 5214112 |
| Molecular Formula | C25H27F3N2O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-butyl-2-methoxy-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | CCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)c1ccccc1OC |
| InChI | InChI=1S/C25H27F3N2O2/c1-3-4-14-30(24(31)22-12-5-6-13-23(22)32-2)18-21-11-8-15-29(21)17-19-9-7-10-20(16-19)25(26,27)28/h5-13,15-16H,3-4,14,17-18H2,1-2H3 |
| InChIKey | DPQNPUAARPUOIL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |