C24H27BrN2O2 — CID 5110037
N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-methoxybenzamide (PubChem CID 5110037) has the molecular formula C24H27BrN2O2 and a molecular weight of 455.40 g/mol. Its IUPAC name is N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-methoxybenzamide.
| Compound Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 5110037 |
| Molecular Formula | C24H27BrN2O2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-methoxybenzamide |
| SMILES | CCCCN(Cc1cccn1Cc1ccc(Br)cc1)C(=O)c1ccccc1OC |
| InChI | InChI=1S/C24H27BrN2O2/c1-3-4-15-27(24(28)22-9-5-6-10-23(22)29-2)18-21-8-7-16-26(21)17-19-11-13-20(25)14-12-19/h5-14,16H,3-4,15,17-18H2,1-2H3 |
| InChIKey | JJIMFFOXAAJFRA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |