C24H25F3N2O — CID 3342497
N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-3-(trifluoromethyl)benzamide (PubChem CID 3342497) has the molecular formula C24H25F3N2O and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3342497 |
| Molecular Formula | C24H25F3N2O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-3-(trifluoromethyl)benzamide |
| SMILES | CCCCN(Cc1cccn1Cc1ccccc1)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H25F3N2O/c1-2-3-14-29(23(30)20-11-7-12-21(16-20)24(25,26)27)18-22-13-8-15-28(22)17-19-9-5-4-6-10-19/h4-13,15-16H,2-3,14,17-18H2,1H3 |
| InChIKey | PITNGAFKJMLMPE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |