C23H23Cl3N2O2 — CID 4684929
2,4-dichloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide (PubChem CID 4684929) has the molecular formula C23H23Cl3N2O2 and a molecular weight of 465.81 g/mol. Its IUPAC name is 2,4-dichloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 2,4-dichloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4684929 |
| Molecular Formula | C23H23Cl3N2O2 |
| Molecular Weight | 465.81 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 2,4-dichloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H23Cl3N2O2/c1-30-12-4-11-28(23(29)21-9-8-19(25)14-22(21)26)16-20-7-3-10-27(20)15-17-5-2-6-18(24)13-17/h2-3,5-10,13-14H,4,11-12,15-16H2,1H3 |
| InChIKey | XCDMRRAFWFEVEY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.81 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|