C25H37ClN2O2 — CID 7499177
(3R)-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)-3,5,5-trimethylhexanamide (PubChem CID 7499177) has the molecular formula C25H37ClN2O2 and a molecular weight of 433.04 g/mol. Its IUPAC name is (3R)-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)-3,5,5-trimethylhexanamide.
| Compound Name | (3R)-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 7499177 |
| Molecular Formula | C25H37ClN2O2 |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (3R)-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)-3,5,5-trimethylhexanamide |
| SMILES | COCCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)C[C@H](C)CC(C)(C)C |
| InChI | InChI=1S/C25H37ClN2O2/c1-20(17-25(2,3)4)15-24(29)28(13-8-14-30-5)19-23-11-7-12-27(23)18-21-9-6-10-22(26)16-21/h6-7,9-12,16,20H,8,13-15,17-19H2,1-5H3/t20-/m0/s1 |
| InChIKey | HOUCZLVDUODQMO-FQEVSTJZSA-N |
| XLogP | 6.02 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|