C21H29ClN2O — CID 5095743
N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)pentanamide (PubChem CID 5095743) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)pentanamide.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)pentanamide |
|---|---|
| PubChem CID | 5095743 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)pentanamide |
| SMILES | CCCCC(=O)N(Cc1cccn1Cc1cccc(Cl)c1)CC(C)C |
| InChI | InChI=1S/C21H29ClN2O/c1-4-5-11-21(25)24(14-17(2)3)16-20-10-7-12-23(20)15-18-8-6-9-19(22)13-18/h6-10,12-13,17H,4-5,11,14-16H2,1-3H3 |
| InChIKey | JVTZFJMGQJNYBH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |