C23H24F2N2O2 — CID 5095440
3-fluoro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide (PubChem CID 5095440) has the molecular formula C23H24F2N2O2 and a molecular weight of 398.45 g/mol. Its IUPAC name is 3-fluoro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-fluoro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 5095440 |
| Molecular Formula | C23H24F2N2O2 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-fluoro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(Cc1cccn1Cc1ccc(F)cc1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C23H24F2N2O2/c1-29-14-4-13-27(23(28)19-5-2-6-21(25)15-19)17-22-7-3-12-26(22)16-18-8-10-20(24)11-9-18/h2-3,5-12,15H,4,13-14,16-17H2,1H3 |
| InChIKey | VGNSNWFIPSVVLU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|