C31H37FN4O5 — CID 3982413
N-[2-[cyclohexyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-3-nitrobenzamide (PubChem CID 3982413) has the molecular formula C31H37FN4O5 and a molecular weight of 564.66 g/mol. Its IUPAC name is N-[2-[cyclohexyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-3-nitrobenzamide.
| Compound Name | N-[2-[cyclohexyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 3982413 |
| Molecular Formula | C31H37FN4O5 |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | N-[2-[cyclohexyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-3-nitrobenzamide |
| SMILES | COCCCN(CC(=O)N(Cc1cccn1Cc1ccc(F)cc1)C1CCCCC1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H37FN4O5/c1-41-19-7-18-34(31(38)25-8-5-11-28(20-25)36(39)40)23-30(37)35(27-9-3-2-4-10-27)22-29-12-6-17-33(29)21-24-13-15-26(32)16-14-24/h5-6,8,11-17,20,27H,2-4,7,9-10,18-19,21-23H2,1H3 |
| InChIKey | CPSHVNYKAOYATN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|