C32H38F3N3O3 — CID 4667060
N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-(3-methoxypropyl)-4-(trifluoromethyl)benzamide (PubChem CID 4667060) has the molecular formula C32H38F3N3O3 and a molecular weight of 569.67 g/mol. Its IUPAC name is N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-(3-methoxypropyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-(3-methoxypropyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4667060 |
| Molecular Formula | C32H38F3N3O3 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-(3-methoxypropyl)-4-(trifluoromethyl)benzamide |
| SMILES | COCCCN(CC(=O)N(Cc1cccn1Cc1ccccc1)C1CCCCC1)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H38F3N3O3/c1-41-21-9-20-37(31(40)26-15-17-27(18-16-26)32(33,34)35)24-30(39)38(28-12-6-3-7-13-28)23-29-14-8-19-36(29)22-25-10-4-2-5-11-25/h2,4-5,8,10-11,14-19,28H,3,6-7,9,12-13,20-24H2,1H3 |
| InChIKey | DHUAPAIGUFTQLG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|