C32H41N3O2 — CID 3961367
N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-pentylbenzamide (PubChem CID 3961367) has the molecular formula C32H41N3O2 and a molecular weight of 499.70 g/mol. Its IUPAC name is N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-pentylbenzamide.
| Compound Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 3961367 |
| Molecular Formula | C32H41N3O2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-pentylbenzamide |
| SMILES | CCCCCN(CC(=O)N(Cc1cccn1Cc1ccccc1)C1CCCCC1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C32H41N3O2/c1-2-3-13-22-34(32(37)28-17-9-5-10-18-28)26-31(36)35(29-19-11-6-12-20-29)25-30-21-14-23-33(30)24-27-15-7-4-8-16-27/h4-5,7-10,14-18,21,23,29H,2-3,6,11-13,19-20,22,24-26H2,1H3 |
| InChIKey | KWQIXCWRSYUGLM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|