C27H38FN3O2 — CID 5001570
2-[acetyl(pentyl)amino]-N-cyclohexyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]acetamide (PubChem CID 5001570) has the molecular formula C27H38FN3O2 and a molecular weight of 455.62 g/mol. Its IUPAC name is 2-[acetyl(pentyl)amino]-N-cyclohexyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]acetamide.
| Compound Name | 2-[acetyl(pentyl)amino]-N-cyclohexyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 5001570 |
| Molecular Formula | C27H38FN3O2 |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 2-[acetyl(pentyl)amino]-N-cyclohexyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]acetamide |
| SMILES | CCCCCN(CC(=O)N(Cc1cccn1Cc1ccc(F)cc1)C1CCCCC1)C(C)=O |
| InChI | InChI=1S/C27H38FN3O2/c1-3-4-8-17-29(22(2)32)21-27(33)31(25-10-6-5-7-11-25)20-26-12-9-18-30(26)19-23-13-15-24(28)16-14-23/h9,12-16,18,25H,3-8,10-11,17,19-21H2,1-2H3 |
| InChIKey | YXYYOQNRRDXNAG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|