C31H47N3O3 — CID 3979769
N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-(3-methoxypropyl)heptanamide (PubChem CID 3979769) has the molecular formula C31H47N3O3 and a molecular weight of 509.74 g/mol. Its IUPAC name is N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-(3-methoxypropyl)heptanamide.
| Compound Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-(3-methoxypropyl)heptanamide |
|---|---|
| PubChem CID | 3979769 |
| Molecular Formula | C31H47N3O3 |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.36 |
| IUPAC Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-cyclohexylamino]-2-oxoethyl]-N-(3-methoxypropyl)heptanamide |
| SMILES | CCCCCCC(=O)N(CCCOC)CC(=O)N(Cc1cccn1Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C31H47N3O3/c1-3-4-5-12-20-30(35)33(22-14-23-37-2)26-31(36)34(28-17-10-7-11-18-28)25-29-19-13-21-32(29)24-27-15-8-6-9-16-27/h6,8-9,13,15-16,19,21,28H,3-5,7,10-12,14,17-18,20,22-26H2,1-2H3 |
| InChIKey | DOZCWHQCPXGLIZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|