C28H43N3O3 — CID 4528927
N-[2-[(1-benzylpyrrol-2-yl)methyl-propan-2-ylamino]-2-oxoethyl]-N-(3-methoxypropyl)heptanamide (PubChem CID 4528927) has the molecular formula C28H43N3O3 and a molecular weight of 469.67 g/mol. Its IUPAC name is N-[2-[(1-benzylpyrrol-2-yl)methyl-propan-2-ylamino]-2-oxoethyl]-N-(3-methoxypropyl)heptanamide.
| Compound Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-propan-2-ylamino]-2-oxoethyl]-N-(3-methoxypropyl)heptanamide |
|---|---|
| PubChem CID | 4528927 |
| Molecular Formula | C28H43N3O3 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.33 |
| IUPAC Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-propan-2-ylamino]-2-oxoethyl]-N-(3-methoxypropyl)heptanamide |
| SMILES | CCCCCCC(=O)N(CCCOC)CC(=O)N(Cc1cccn1Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C28H43N3O3/c1-5-6-7-11-17-27(32)30(19-13-20-34-4)23-28(33)31(24(2)3)22-26-16-12-18-29(26)21-25-14-9-8-10-15-25/h8-10,12,14-16,18,24H,5-7,11,13,17,19-23H2,1-4H3 |
| InChIKey | CGADJRODZQQBKT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|