C26H37BrN2O — CID 42763553
N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyloctanamide (PubChem CID 42763553) has the molecular formula C26H37BrN2O and a molecular weight of 473.50 g/mol. Its IUPAC name is N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyloctanamide.
| Compound Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyloctanamide |
|---|---|
| PubChem CID | 42763553 |
| Molecular Formula | C26H37BrN2O |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyloctanamide |
| SMILES | CCCCCCCC(=O)N(Cc1cccn1Cc1ccc(Br)cc1)C1CCCCC1 |
| InChI | InChI=1S/C26H37BrN2O/c1-2-3-4-5-9-14-26(30)29(24-11-7-6-8-12-24)21-25-13-10-19-28(25)20-22-15-17-23(27)18-16-22/h10,13,15-19,24H,2-9,11-12,14,20-21H2,1H3 |
| InChIKey | LHNFSIGJONIUHI-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|