C23H32BrN3O2 — CID 42768575
N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-(2-methoxyethylamino)acetamide (PubChem CID 42768575) has the molecular formula C23H32BrN3O2 and a molecular weight of 462.43 g/mol. Its IUPAC name is N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 42768575 |
| Molecular Formula | C23H32BrN3O2 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)N(Cc1cccn1Cc1ccc(Br)cc1)C1CCCCC1 |
| InChI | InChI=1S/C23H32BrN3O2/c1-29-15-13-25-16-23(28)27(21-6-3-2-4-7-21)18-22-8-5-14-26(22)17-19-9-11-20(24)12-10-19/h5,8-12,14,21,25H,2-4,6-7,13,15-18H2,1H3 |
| InChIKey | XRLWZHFDHOLNGH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|