C24H35N3O2 — CID 42770742
N-[(1-benzylpyrrol-2-yl)methyl]-N-cyclohexyl-2-(3-methoxypropylamino)acetamide (PubChem CID 42770742) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-cyclohexyl-2-(3-methoxypropylamino)acetamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-cyclohexyl-2-(3-methoxypropylamino)acetamide |
|---|---|
| PubChem CID | 42770742 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-cyclohexyl-2-(3-methoxypropylamino)acetamide |
| SMILES | COCCCNCC(=O)N(Cc1cccn1Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H35N3O2/c1-29-17-9-15-25-18-24(28)27(22-12-6-3-7-13-22)20-23-14-8-16-26(23)19-21-10-4-2-5-11-21/h2,4-5,8,10-11,14,16,22,25H,3,6-7,9,12-13,15,17-20H2,1H3 |
| InChIKey | GHDHQGAFIMLQOT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|