C25H30FN3O2 — CID 42768556
N-benzyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2-(3-methoxypropylamino)acetamide (PubChem CID 42768556) has the molecular formula C25H30FN3O2 and a molecular weight of 423.53 g/mol. Its IUPAC name is N-benzyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2-(3-methoxypropylamino)acetamide.
| Compound Name | N-benzyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2-(3-methoxypropylamino)acetamide |
|---|---|
| PubChem CID | 42768556 |
| Molecular Formula | C25H30FN3O2 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-benzyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2-(3-methoxypropylamino)acetamide |
| SMILES | COCCCNCC(=O)N(Cc1ccccc1)Cc1cccn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H30FN3O2/c1-31-16-6-14-27-17-25(30)29(19-21-7-3-2-4-8-21)20-24-9-5-15-28(24)18-22-10-12-23(26)13-11-22/h2-5,7-13,15,27H,6,14,16-20H2,1H3 |
| InChIKey | LHZIGYQLEXOLNH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|