C27H30FN3O3 — CID 4201261
N-[2-[(1-benzylpyrrol-2-yl)methyl-(2-methoxyethyl)amino]-2-oxoethyl]-4-fluoro-N-prop-2-enylbenzamide (PubChem CID 4201261) has the molecular formula C27H30FN3O3 and a molecular weight of 463.55 g/mol. Its IUPAC name is N-[2-[(1-benzylpyrrol-2-yl)methyl-(2-methoxyethyl)amino]-2-oxoethyl]-4-fluoro-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-(2-methoxyethyl)amino]-2-oxoethyl]-4-fluoro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 4201261 |
| Molecular Formula | C27H30FN3O3 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-[2-[(1-benzylpyrrol-2-yl)methyl-(2-methoxyethyl)amino]-2-oxoethyl]-4-fluoro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(CCOC)Cc1cccn1Cc1ccccc1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H30FN3O3/c1-3-15-31(27(33)23-11-13-24(28)14-12-23)21-26(32)30(17-18-34-2)20-25-10-7-16-29(25)19-22-8-5-4-6-9-22/h3-14,16H,1,15,17-21H2,2H3 |
| InChIKey | UQTPYCCMHJGDNR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|