C33H35N3O2 — CID 42777086
N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-ethyl-N-prop-2-enylbenzamide (PubChem CID 42777086) has the molecular formula C33H35N3O2 and a molecular weight of 505.66 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-ethyl-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-ethyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42777086 |
| Molecular Formula | C33H35N3O2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-ethyl-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccn1Cc1ccccc1)C(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C33H35N3O2/c1-3-21-35(33(38)30-19-17-27(4-2)18-20-30)26-32(37)36(24-29-14-9-6-10-15-29)25-31-16-11-22-34(31)23-28-12-7-5-8-13-28/h3,5-20,22H,1,4,21,23-26H2,2H3 |
| InChIKey | FPGLOANUKTVGLN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|