C26H29FN2O — CID 5028064
4-butyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbenzamide (PubChem CID 5028064) has the molecular formula C26H29FN2O and a molecular weight of 404.53 g/mol. Its IUPAC name is 4-butyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-butyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 5028064 |
| Molecular Formula | C26H29FN2O |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 4-butyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1cccn1Cc1ccc(F)cc1)C(=O)c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C26H29FN2O/c1-3-5-7-21-9-13-23(14-10-21)26(30)29(17-4-2)20-25-8-6-18-28(25)19-22-11-15-24(27)16-12-22/h4,6,8-16,18H,2-3,5,7,17,19-20H2,1H3 |
| InChIKey | PEQDVWOTOMZONH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|