C17H17Cl2FN2O — CID 42663140
2,2-dichloro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylacetamide (PubChem CID 42663140) has the molecular formula C17H17Cl2FN2O and a molecular weight of 355.24 g/mol. Its IUPAC name is 2,2-dichloro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylacetamide.
| Compound Name | 2,2-dichloro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 42663140 |
| Molecular Formula | C17H17Cl2FN2O |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2,2-dichloro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1cccn1Cc1ccc(F)cc1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C17H17Cl2FN2O/c1-2-9-22(17(23)16(18)19)12-15-4-3-10-21(15)11-13-5-7-14(20)8-6-13/h2-8,10,16H,1,9,11-12H2 |
| InChIKey | IWTWFAZDKSLJIU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|