C23H21F4N3O — CID 3348537
1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 3348537) has the molecular formula C23H21F4N3O and a molecular weight of 431.43 g/mol. Its IUPAC name is 1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 3348537 |
| Molecular Formula | C23H21F4N3O |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | C=CCN(Cc1cccn1Cc1ccc(F)cc1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F4N3O/c1-2-13-30(22(31)28-20-11-7-18(8-12-20)23(25,26)27)16-21-4-3-14-29(21)15-17-5-9-19(24)10-6-17/h2-12,14H,1,13,15-16H2,(H,28,31) |
| InChIKey | HDMGWXGFBNPSSM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|