C22H20ClF2N3O — CID 4017208
3-(3-chloro-4-fluorophenyl)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea (PubChem CID 4017208) has the molecular formula C22H20ClF2N3O and a molecular weight of 415.87 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 4017208 |
| Molecular Formula | C22H20ClF2N3O |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cccn1Cc1ccc(F)cc1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H20ClF2N3O/c1-2-11-28(22(29)26-18-9-10-21(25)20(23)13-18)15-19-4-3-12-27(19)14-16-5-7-17(24)8-6-16/h2-10,12-13H,1,11,14-15H2,(H,26,29) |
| InChIKey | FNHPVPLRZKRCTH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|