C24H27F2N3O — CID 3268464
3-(3-fluorophenyl)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea (PubChem CID 3268464) has the molecular formula C24H27F2N3O and a molecular weight of 411.50 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea.
| Compound Name | 3-(3-fluorophenyl)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea |
|---|---|
| PubChem CID | 3268464 |
| Molecular Formula | C24H27F2N3O |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 3-(3-fluorophenyl)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea |
| SMILES | CCCCCN(Cc1cccn1Cc1ccc(F)cc1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H27F2N3O/c1-2-3-4-14-29(24(30)27-22-8-5-7-21(26)16-22)18-23-9-6-15-28(23)17-19-10-12-20(25)13-11-19/h5-13,15-16H,2-4,14,17-18H2,1H3,(H,27,30) |
| InChIKey | CTTCVNBVHBSYNG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|