C23H25ClFN3O — CID 5125487
1-butyl-1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3-fluorophenyl)urea (PubChem CID 5125487) has the molecular formula C23H25ClFN3O and a molecular weight of 413.92 g/mol. Its IUPAC name is 1-butyl-1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-butyl-1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 5125487 |
| Molecular Formula | C23H25ClFN3O |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-butyl-1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3-fluorophenyl)urea |
| SMILES | CCCCN(Cc1cccn1Cc1ccccc1Cl)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C23H25ClFN3O/c1-2-3-13-28(23(29)26-20-10-6-9-19(25)15-20)17-21-11-7-14-27(21)16-18-8-4-5-12-22(18)24/h4-12,14-15H,2-3,13,16-17H2,1H3,(H,26,29) |
| InChIKey | DXJSRAVPFDEIIU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |