C25H30FN3O4 — CID 5210617
3-(3,5-dimethoxyphenyl)-1-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-(3-methoxypropyl)urea (PubChem CID 5210617) has the molecular formula C25H30FN3O4 and a molecular weight of 455.53 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-1-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-(3-methoxypropyl)urea.
| Compound Name | 3-(3,5-dimethoxyphenyl)-1-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 5210617 |
| Molecular Formula | C25H30FN3O4 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-1-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-(3-methoxypropyl)urea |
| SMILES | COCCCN(Cc1cccn1Cc1cccc(F)c1)C(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C25H30FN3O4/c1-31-12-6-11-29(25(30)27-21-14-23(32-2)16-24(15-21)33-3)18-22-9-5-10-28(22)17-19-7-4-8-20(26)13-19/h4-5,7-10,13-16H,6,11-12,17-18H2,1-3H3,(H,27,30) |
| InChIKey | PBWHORDLTDFUEO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|