C23H25BrFN3O2 — CID 3385320
3-(2-bromophenyl)-1-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-(3-methoxypropyl)urea (PubChem CID 3385320) has the molecular formula C23H25BrFN3O2 and a molecular weight of 474.37 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-(3-methoxypropyl)urea.
| Compound Name | 3-(2-bromophenyl)-1-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 3385320 |
| Molecular Formula | C23H25BrFN3O2 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 3-(2-bromophenyl)-1-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-1-(3-methoxypropyl)urea |
| SMILES | COCCCN(Cc1cccn1Cc1cccc(F)c1)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C23H25BrFN3O2/c1-30-14-6-13-28(23(29)26-22-11-3-2-10-21(22)24)17-20-9-5-12-27(20)16-18-7-4-8-19(25)15-18/h2-5,7-12,15H,6,13-14,16-17H2,1H3,(H,26,29) |
| InChIKey | JZIPOZLRANOVDQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|