C23H23Cl2N3O — CID 4243169
3-(2,3-dichlorophenyl)-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea (PubChem CID 4243169) has the molecular formula C23H23Cl2N3O and a molecular weight of 428.36 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea.
| Compound Name | 3-(2,3-dichlorophenyl)-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 4243169 |
| Molecular Formula | C23H23Cl2N3O |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(C)c1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H23Cl2N3O/c1-3-12-28(23(29)26-21-11-5-10-20(24)22(21)25)16-19-9-6-13-27(19)15-18-8-4-7-17(2)14-18/h3-11,13-14H,1,12,15-16H2,2H3,(H,26,29) |
| InChIKey | DODMJDHMWDGSNG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|