C23H23N3O3 — CID 42663050
N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-nitro-N-prop-2-enylbenzamide (PubChem CID 42663050) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-nitro-N-prop-2-enylbenzamide.
| Compound Name | N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42663050 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(C)c1)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H23N3O3/c1-3-13-25(23(27)20-9-11-21(12-10-20)26(28)29)17-22-8-5-14-24(22)16-19-7-4-6-18(2)15-19/h3-12,14-15H,1,13,16-17H2,2H3 |
| InChIKey | VGBMNMKFMFEYIS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|