C22H19ClFN3O3 — CID 5135461
4-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-nitro-N-prop-2-enylbenzamide (PubChem CID 5135461) has the molecular formula C22H19ClFN3O3 and a molecular weight of 427.86 g/mol. Its IUPAC name is 4-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-nitro-N-prop-2-enylbenzamide.
| Compound Name | 4-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 5135461 |
| Molecular Formula | C22H19ClFN3O3 |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(F)c1)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H19ClFN3O3/c1-2-10-26(22(28)17-8-9-20(23)21(13-17)27(29)30)15-19-7-4-11-25(19)14-16-5-3-6-18(24)12-16/h2-9,11-13H,1,10,14-15H2 |
| InChIKey | WMHKDZYYBLPNQE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|