C24H23FN2O — CID 5123354
N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-phenyl-N-prop-2-enylprop-2-enamide (PubChem CID 5123354) has the molecular formula C24H23FN2O and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-phenyl-N-prop-2-enylprop-2-enamide.
| Compound Name | N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-phenyl-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 5123354 |
| Molecular Formula | C24H23FN2O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-phenyl-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(F)c1)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C24H23FN2O/c1-2-15-27(24(28)14-13-20-8-4-3-5-9-20)19-23-12-7-16-26(23)18-21-10-6-11-22(25)17-21/h2-14,16-17H,1,15,18-19H2 |
| InChIKey | AWNBJIPHWHBJJL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|