C33H33N3O2 — CID 42777082
(E)-N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide (PubChem CID 42777082) has the molecular formula C33H33N3O2 and a molecular weight of 503.65 g/mol. Its IUPAC name is (E)-N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 42777082 |
| Molecular Formula | C33H33N3O2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | (E)-N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccn1Cc1ccccc1)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C33H33N3O2/c1-2-22-35(32(37)21-20-28-13-6-3-7-14-28)27-33(38)36(25-30-17-10-5-11-18-30)26-31-19-12-23-34(31)24-29-15-8-4-9-16-29/h2-21,23H,1,22,24-27H2/b21-20+ |
| InChIKey | CXVBWTWFGBUXDZ-QZQOTICOSA-N |
| XLogP | 5.79 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|