C23H21NO — CID 11163228
(Z)-N,N-dibenzyl-3-phenylprop-2-enamide (PubChem CID 11163228) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is (Z)-N,N-dibenzyl-3-phenylprop-2-enamide.
| Compound Name | (Z)-N,N-dibenzyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 11163228 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (Z)-N,N-dibenzyl-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C\c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H21NO/c25-23(17-16-20-10-4-1-5-11-20)24(18-21-12-6-2-7-13-21)19-22-14-8-3-9-15-22/h1-17H,18-19H2/b17-16- |
| InChIKey | PYKTZARZFNZUGD-MSUUIHNZSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|